C23H26N4O3 — CID 131921932
3-[[3-(3,5-dimethylpyrazol-1-yl)benzoyl]amino]-N-(2-methoxyethyl)-2-methylbenzamide (PubChem CID 131921932) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-[[3-(3,5-dimethylpyrazol-1-yl)benzoyl]amino]-N-(2-methoxyethyl)-2-methylbenzamide.
| Compound Name | 3-[[3-(3,5-dimethylpyrazol-1-yl)benzoyl]amino]-N-(2-methoxyethyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 131921932 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 3-[[3-(3,5-dimethylpyrazol-1-yl)benzoyl]amino]-N-(2-methoxyethyl)-2-methylbenzamide |
| SMILES | COCCNC(=O)c1cccc(NC(=O)c2cccc(-n3nc(C)cc3C)c2)c1C |
| InChI | InChI=1S/C23H26N4O3/c1-15-13-16(2)27(26-15)19-8-5-7-18(14-19)22(28)25-21-10-6-9-20(17(21)3)23(29)24-11-12-30-4/h5-10,13-14H,11-12H2,1-4H3,(H,24,29)(H,25,28) |
| InChIKey | KMEOOFJRRILLPY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|