C21H23N5O3 — CID 176501437
3-cyclopropyl-N-[3-(2-methoxyethylcarbamoyl)-2-methylphenyl]imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 176501437) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 3-cyclopropyl-N-[3-(2-methoxyethylcarbamoyl)-2-methylphenyl]imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 3-cyclopropyl-N-[3-(2-methoxyethylcarbamoyl)-2-methylphenyl]imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 176501437 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 3-cyclopropyl-N-[3-(2-methoxyethylcarbamoyl)-2-methylphenyl]imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | COCCNC(=O)c1cccc(NC(=O)c2cnc3c(c2)ncn3C2CC2)c1C |
| InChI | InChI=1S/C21H23N5O3/c1-13-16(21(28)22-8-9-29-2)4-3-5-17(13)25-20(27)14-10-18-19(23-11-14)26(12-24-18)15-6-7-15/h3-5,10-12,15H,6-9H2,1-2H3,(H,22,28)(H,25,27) |
| InChIKey | GJBFAAOCPMQVRT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|