C15H19N3O3S — CID 72859306
3-(3,5-dimethylpyrazol-1-yl)-N-(2-methylsulfonylethyl)benzamide (PubChem CID 72859306) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-(2-methylsulfonylethyl)benzamide.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-(2-methylsulfonylethyl)benzamide |
|---|---|
| PubChem CID | 72859306 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-(2-methylsulfonylethyl)benzamide |
| SMILES | Cc1cc(C)n(-c2cccc(C(=O)NCCS(C)(=O)=O)c2)n1 |
| InChI | InChI=1S/C15H19N3O3S/c1-11-9-12(2)18(17-11)14-6-4-5-13(10-14)15(19)16-7-8-22(3,20)21/h4-6,9-10H,7-8H2,1-3H3,(H,16,19) |
| InChIKey | FLTUNPYHOMZLLD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |