C19H16N2O3 — CID 170462643
benzyl N-[4-(3-isocyanatophenyl)but-3-ynyl]carbamate (PubChem CID 170462643) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is benzyl N-[4-(3-isocyanatophenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(3-isocyanatophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462643 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | benzyl N-[4-(3-isocyanatophenyl)but-3-ynyl]carbamate |
| SMILES | O=C=Nc1cccc(C#CCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H16N2O3/c22-15-21-18-11-6-10-16(13-18)7-4-5-12-20-19(23)24-14-17-8-2-1-3-9-17/h1-3,6,8-11,13H,5,12,14H2,(H,20,23) |
| InChIKey | IBQQMNOMLFETNE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|