C23H25NO4 — CID 170463464
tert-butyl 3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoate (PubChem CID 170463464) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl 3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoate.
| Compound Name | tert-butyl 3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoate |
|---|---|
| PubChem CID | 170463464 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | tert-butyl 3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(C#CCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H25NO4/c1-23(2,3)28-21(25)20-14-9-13-18(16-20)10-7-8-15-24-22(26)27-17-19-11-5-4-6-12-19/h4-6,9,11-14,16H,8,15,17H2,1-3H3,(H,24,26) |
| InChIKey | OBQHJAFZCLFZOJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|