C19H18N2O2S — CID 170462528
benzyl N-[4-(2-carbamothioylphenyl)but-3-ynyl]carbamate (PubChem CID 170462528) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is benzyl N-[4-(2-carbamothioylphenyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(2-carbamothioylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462528 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | benzyl N-[4-(2-carbamothioylphenyl)but-3-ynyl]carbamate |
| SMILES | NC(=S)c1ccccc1C#CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18N2O2S/c20-18(24)17-12-5-4-10-16(17)11-6-7-13-21-19(22)23-14-15-8-2-1-3-9-15/h1-5,8-10,12H,7,13-14H2,(H2,20,24)(H,21,22) |
| InChIKey | OWYTYVMVSVEPLN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|