C17H15NO4S — CID 170462106
4-[4-(phenylmethoxycarbonylamino)but-1-ynyl]thiophene-3-carboxylic acid (PubChem CID 170462106) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-[4-(phenylmethoxycarbonylamino)but-1-ynyl]thiophene-3-carboxylic acid.
| Compound Name | 4-[4-(phenylmethoxycarbonylamino)but-1-ynyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 170462106 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-[4-(phenylmethoxycarbonylamino)but-1-ynyl]thiophene-3-carboxylic acid |
| SMILES | O=C(NCCC#Cc1cscc1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C17H15NO4S/c19-16(20)15-12-23-11-14(15)8-4-5-9-18-17(21)22-10-13-6-2-1-3-7-13/h1-3,6-7,11-12H,5,9-10H2,(H,18,21)(H,19,20) |
| InChIKey | RSEGWWDVDFLROZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|