C19H18N2O4 — CID 170462977
4-amino-3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoic acid (PubChem CID 170462977) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 4-amino-3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoic acid.
| Compound Name | 4-amino-3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoic acid |
|---|---|
| PubChem CID | 170462977 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-amino-3-[4-(phenylmethoxycarbonylamino)but-1-ynyl]benzoic acid |
| SMILES | Nc1ccc(C(=O)O)cc1C#CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18N2O4/c20-17-10-9-16(18(22)23)12-15(17)8-4-5-11-21-19(24)25-13-14-6-2-1-3-7-14/h1-3,6-7,9-10,12H,5,11,13,20H2,(H,21,24)(H,22,23) |
| InChIKey | PUWLCGWLVGUKHR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|