C23H22F3NO3 — CID 158691990
benzyl N-[4-oxo-8-[2-(trifluoromethyl)phenyl]oct-7-ynyl]carbamate (PubChem CID 158691990) has the molecular formula C23H22F3NO3 and a molecular weight of 417.43 g/mol. Its IUPAC name is benzyl N-[4-oxo-8-[2-(trifluoromethyl)phenyl]oct-7-ynyl]carbamate.
| Compound Name | benzyl N-[4-oxo-8-[2-(trifluoromethyl)phenyl]oct-7-ynyl]carbamate |
|---|---|
| PubChem CID | 158691990 |
| Molecular Formula | C23H22F3NO3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | benzyl N-[4-oxo-8-[2-(trifluoromethyl)phenyl]oct-7-ynyl]carbamate |
| SMILES | O=C(CCC#Cc1ccccc1C(F)(F)F)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H22F3NO3/c24-23(25,26)21-15-7-5-12-19(21)11-4-6-13-20(28)14-8-16-27-22(29)30-17-18-9-2-1-3-10-18/h1-3,5,7,9-10,12,15H,6,8,13-14,16-17H2,(H,27,29) |
| InChIKey | IGLVDNBVRBVNLS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|