C18H15F3N2O2 — CID 170462925
benzyl N-[4-[3-(trifluoromethyl)-2-pyridinyl]but-3-ynyl]carbamate (PubChem CID 170462925) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is benzyl N-[4-[3-(trifluoromethyl)-2-pyridinyl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[3-(trifluoromethyl)-2-pyridinyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462925 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | benzyl N-[4-[3-(trifluoromethyl)-2-pyridinyl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ncccc1C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C18H15F3N2O2/c19-18(20,21)15-9-6-12-22-16(15)10-4-5-11-23-17(24)25-13-14-7-2-1-3-8-14/h1-3,6-9,12H,5,11,13H2,(H,23,24) |
| InChIKey | ISJSCYIHBJVHDB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|