C18H15FN2O4 — CID 170462946
3-fluoro-2-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-4-carboxylic acid (PubChem CID 170462946) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is 3-fluoro-2-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-4-carboxylic acid.
| Compound Name | 3-fluoro-2-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 170462946 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-fluoro-2-[4-(phenylmethoxycarbonylamino)but-1-ynyl]pyridine-4-carboxylic acid |
| SMILES | O=C(NCCC#Cc1nccc(C(=O)O)c1F)OCc1ccccc1 |
| InChI | InChI=1S/C18H15FN2O4/c19-16-14(17(22)23)9-11-20-15(16)8-4-5-10-21-18(24)25-12-13-6-2-1-3-7-13/h1-3,6-7,9,11H,5,10,12H2,(H,21,24)(H,22,23) |
| InChIKey | HZNHNVDAKGEDSU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|