C26H20F3NO3 — CID 170461315
9H-fluoren-9-ylmethyl N-[4-[3-hydroxy-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate (PubChem CID 170461315) has the molecular formula C26H20F3NO3 and a molecular weight of 451.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[3-hydroxy-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[3-hydroxy-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461315 |
| Molecular Formula | C26H20F3NO3 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[3-hydroxy-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cc(O)cc(C(F)(F)F)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H20F3NO3/c27-26(28,29)18-13-17(14-19(31)15-18)7-5-6-12-30-25(32)33-16-24-22-10-3-1-8-20(22)21-9-2-4-11-23(21)24/h1-4,8-11,13-15,24,31H,6,12,16H2,(H,30,32) |
| InChIKey | YWKRPPSIVMXSDC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|