C27H22F3NO3 — CID 170461600
9H-fluoren-9-ylmethyl N-[4-[3-methoxy-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate (PubChem CID 170461600) has the molecular formula C27H22F3NO3 and a molecular weight of 465.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[3-methoxy-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[3-methoxy-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461600 |
| Molecular Formula | C27H22F3NO3 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[3-methoxy-5-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
| SMILES | COc1cc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H22F3NO3/c1-33-20-15-18(14-19(16-20)27(28,29)30)8-6-7-13-31-26(32)34-17-25-23-11-4-2-9-21(23)22-10-3-5-12-24(22)25/h2-5,9-12,14-16,25H,7,13,17H2,1H3,(H,31,32) |
| InChIKey | AVNOUXSSPLYPBW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|