C27H20F3NO4 — CID 170461671
2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-5-(trifluoromethyl)benzoic acid (PubChem CID 170461671) has the molecular formula C27H20F3NO4 and a molecular weight of 479.45 g/mol. Its IUPAC name is 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 170461671 |
| Molecular Formula | C27H20F3NO4 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(NCCC#Cc1ccc(C(F)(F)F)cc1C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H20F3NO4/c28-27(29,30)18-13-12-17(23(15-18)25(32)33)7-5-6-14-31-26(34)35-16-24-21-10-3-1-8-19(21)20-9-2-4-11-22(20)24/h1-4,8-13,15,24H,6,14,16H2,(H,31,34)(H,32,33) |
| InChIKey | RUWRHUGTUVDZPT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|