C26H21NO5 — CID 170461087
4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-3-hydroxybenzoic acid (PubChem CID 170461087) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-3-hydroxybenzoic acid.
| Compound Name | 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 170461087 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-3-hydroxybenzoic acid |
| SMILES | O=C(NCCC#Cc1ccc(C(=O)O)cc1O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H21NO5/c28-24-15-18(25(29)30)13-12-17(24)7-5-6-14-27-26(31)32-16-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-4,8-13,15,23,28H,6,14,16H2,(H,27,31)(H,29,30) |
| InChIKey | SNXGXMUDKJPGDT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|