C25H18ClF2NO2 — CID 170460546
9H-fluoren-9-ylmethyl N-[4-(3-chloro-2,4-difluorophenyl)but-3-ynyl]carbamate (PubChem CID 170460546) has the molecular formula C25H18ClF2NO2 and a molecular weight of 437.87 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-chloro-2,4-difluorophenyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-chloro-2,4-difluorophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460546 |
| Molecular Formula | C25H18ClF2NO2 |
| Molecular Weight | 437.87 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-chloro-2,4-difluorophenyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc(F)c(Cl)c1F)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H18ClF2NO2/c26-23-22(27)13-12-16(24(23)28)7-5-6-14-29-25(30)31-15-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-4,8-13,21H,6,14-15H2,(H,29,30) |
| InChIKey | ALQYMFKWRYGINQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.87 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|