C25H20ClFN2O2 — CID 170460796
9H-fluoren-9-ylmethyl N-[4-(2-amino-3-chloro-5-fluorophenyl)but-3-ynyl]carbamate (PubChem CID 170460796) has the molecular formula C25H20ClFN2O2 and a molecular weight of 434.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-amino-3-chloro-5-fluorophenyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-amino-3-chloro-5-fluorophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460796 |
| Molecular Formula | C25H20ClFN2O2 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-amino-3-chloro-5-fluorophenyl)but-3-ynyl]carbamate |
| SMILES | Nc1c(Cl)cc(F)cc1C#CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H20ClFN2O2/c26-23-14-17(27)13-16(24(23)28)7-5-6-12-29-25(30)31-15-22-20-10-3-1-8-18(20)19-9-2-4-11-21(19)22/h1-4,8-11,13-14,22H,6,12,15,28H2,(H,29,30) |
| InChIKey | UDXZHOLEAOPWHH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|