C23H18ClNO2S — CID 170460123
9H-fluoren-9-ylmethyl N-[4-(5-chlorothiophen-2-yl)but-3-ynyl]carbamate (PubChem CID 170460123) has the molecular formula C23H18ClNO2S and a molecular weight of 407.92 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(5-chlorothiophen-2-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(5-chlorothiophen-2-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460123 |
| Molecular Formula | C23H18ClNO2S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(5-chlorothiophen-2-yl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc(Cl)s1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H18ClNO2S/c24-22-13-12-16(28-22)7-5-6-14-25-23(26)27-15-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-4,8-13,21H,6,14-15H2,(H,25,26) |
| InChIKey | FGZZENOMLOWKAB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|