C24H21NO3S — CID 170460160
9H-fluoren-9-ylmethyl N-[4-[5-(hydroxymethyl)thiophen-2-yl]but-3-ynyl]carbamate (PubChem CID 170460160) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[5-(hydroxymethyl)thiophen-2-yl]but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[5-(hydroxymethyl)thiophen-2-yl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460160 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[5-(hydroxymethyl)thiophen-2-yl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc(CO)s1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H21NO3S/c26-15-18-13-12-17(29-18)7-5-6-14-25-24(27)28-16-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-4,8-13,23,26H,6,14-16H2,(H,25,27) |
| InChIKey | ZSODPZPDNGJADF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|