C24H19NO4 — CID 170460154
9H-fluoren-9-ylmethyl N-[4-(5-formylfuran-2-yl)but-3-ynyl]carbamate (PubChem CID 170460154) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(5-formylfuran-2-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(5-formylfuran-2-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460154 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(5-formylfuran-2-yl)but-3-ynyl]carbamate |
| SMILES | O=Cc1ccc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)o1 |
| InChI | InChI=1S/C24H19NO4/c26-15-18-13-12-17(29-18)7-5-6-14-25-24(27)28-16-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-4,8-13,15,23H,6,14,16H2,(H,25,27) |
| InChIKey | TWDLVFZPKYJNQQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|