C27H23NO4 — CID 170461022
9H-fluoren-9-ylmethyl N-[4-(4-formyl-3-methoxyphenyl)but-3-ynyl]carbamate (PubChem CID 170461022) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(4-formyl-3-methoxyphenyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(4-formyl-3-methoxyphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461022 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(4-formyl-3-methoxyphenyl)but-3-ynyl]carbamate |
| SMILES | COc1cc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)ccc1C=O |
| InChI | InChI=1S/C27H23NO4/c1-31-26-16-19(13-14-20(26)17-29)8-6-7-15-28-27(30)32-18-25-23-11-4-2-9-21(23)22-10-3-5-12-24(22)25/h2-5,9-14,16-17,25H,7,15,18H2,1H3,(H,28,30) |
| InChIKey | IXJXPXJLESMYKI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|