C27H23NO3 — CID 170460664
9H-fluoren-9-ylmethyl N-[4-(3-formyl-5-methylphenyl)but-3-ynyl]carbamate (PubChem CID 170460664) has the molecular formula C27H23NO3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-formyl-5-methylphenyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-formyl-5-methylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460664 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-formyl-5-methylphenyl)but-3-ynyl]carbamate |
| SMILES | Cc1cc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc(C=O)c1 |
| InChI | InChI=1S/C27H23NO3/c1-19-14-20(16-21(15-19)17-29)8-6-7-13-28-27(30)31-18-26-24-11-4-2-9-22(24)23-10-3-5-12-25(23)26/h2-5,9-12,14-17,26H,7,13,18H2,1H3,(H,28,30) |
| InChIKey | VWRQCHWWBWGVOA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|