C26H20ClNO3 — CID 170460629
9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-formylphenyl)but-3-ynyl]carbamate (PubChem CID 170460629) has the molecular formula C26H20ClNO3 and a molecular weight of 429.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-formylphenyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-formylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460629 |
| Molecular Formula | C26H20ClNO3 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-chloro-6-formylphenyl)but-3-ynyl]carbamate |
| SMILES | O=Cc1cccc(Cl)c1C#CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H20ClNO3/c27-25-14-7-8-18(16-29)19(25)9-5-6-15-28-26(30)31-17-24-22-12-3-1-10-20(22)21-11-2-4-13-23(21)24/h1-4,7-8,10-14,16,24H,6,15,17H2,(H,28,30) |
| InChIKey | DWZZURSCCUEPRU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|