C28H22N2O3 — CID 170461522
9H-fluoren-9-ylmethyl N-[4-(3-formyl-1H-indol-4-yl)but-3-ynyl]carbamate (PubChem CID 170461522) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-formyl-1H-indol-4-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-formyl-1H-indol-4-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461522 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-formyl-1H-indol-4-yl)but-3-ynyl]carbamate |
| SMILES | O=Cc1c[nH]c2cccc(C#CCCNC(=O)OCC3c4ccccc4-c4ccccc43)c12 |
| InChI | InChI=1S/C28H22N2O3/c31-17-20-16-30-26-14-7-9-19(27(20)26)8-5-6-15-29-28(32)33-18-25-23-12-3-1-10-21(23)22-11-2-4-13-24(22)25/h1-4,7,9-14,16-17,25,30H,6,15,18H2,(H,29,32) |
| InChIKey | JDTDBTBBDFARDA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|