C26H23NO4S — CID 170461003
9H-fluoren-9-ylmethyl N-[4-(2-methylsulfonylphenyl)but-3-ynyl]carbamate (PubChem CID 170461003) has the molecular formula C26H23NO4S and a molecular weight of 445.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-methylsulfonylphenyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-methylsulfonylphenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461003 |
| Molecular Formula | C26H23NO4S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-methylsulfonylphenyl)but-3-ynyl]carbamate |
| SMILES | CS(=O)(=O)c1ccccc1C#CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H23NO4S/c1-32(29,30)25-16-7-2-10-19(25)11-8-9-17-27-26(28)31-18-24-22-14-5-3-12-20(22)21-13-4-6-15-23(21)24/h2-7,10,12-16,24H,9,17-18H2,1H3,(H,27,28) |
| InChIKey | QUTXKLLLBZEACO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|