C26H21N3O2 — CID 170460885
9H-fluoren-9-ylmethyl N-[4-(1H-indazol-7-yl)but-3-ynyl]carbamate (PubChem CID 170460885) has the molecular formula C26H21N3O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(1H-indazol-7-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(1H-indazol-7-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460885 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(1H-indazol-7-yl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cccc2cn[nH]c12)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H21N3O2/c30-26(27-15-6-5-8-18-9-7-10-19-16-28-29-25(18)19)31-17-24-22-13-3-1-11-20(22)21-12-2-4-14-23(21)24/h1-4,7,9-14,16,24H,6,15,17H2,(H,27,30)(H,28,29) |
| InChIKey | IBADDZJTPGEDCP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|