C28H28N2O4 — CID 170461648
ethyl 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 170461648) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is ethyl 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 170461648 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | ethyl 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)c1C |
| InChI | InChI=1S/C28H28N2O4/c1-4-33-27(31)26-18(2)20(19(3)30-26)11-9-10-16-29-28(32)34-17-25-23-14-7-5-12-21(23)22-13-6-8-15-24(22)25/h5-8,12-15,25,30H,4,10,16-17H2,1-3H3,(H,29,32) |
| InChIKey | VNKWXRSGQINTLB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|