C23H19N3O4 — CID 170460412
9H-fluoren-9-ylmethyl N-[4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-ynyl]carbamate (PubChem CID 170460412) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460412 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1c(O)nc[nH]c1=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H19N3O4/c27-21-19(22(28)26-14-25-21)11-5-6-12-24-23(29)30-13-20-17-9-3-1-7-15(17)16-8-2-4-10-18(16)20/h1-4,7-10,14,20H,6,12-13H2,(H,24,29)(H2,25,26,27,28) |
| InChIKey | MSIDACSXPBNFEI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|