C25H19N3O4 — CID 170460933
9H-fluoren-9-ylmethyl N-[4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-ynyl]carbamate (PubChem CID 170460933) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460933 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-oxo-3H-[1,3]oxazolo[4,5-b]pyridin-6-yl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cnc2[nH]c(=O)oc2c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H19N3O4/c29-24(26-12-6-5-7-16-13-22-23(27-14-16)28-25(30)32-22)31-15-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-4,8-11,13-14,21H,6,12,15H2,(H,26,29)(H,27,28,30) |
| InChIKey | WNHSLWDDBFBAQS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|