C25H24N4O2 — CID 170460862
9H-fluoren-9-ylmethyl N-[4-[2-(dimethylamino)pyrimidin-5-yl]but-3-ynyl]carbamate (PubChem CID 170460862) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[2-(dimethylamino)pyrimidin-5-yl]but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[2-(dimethylamino)pyrimidin-5-yl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460862 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[2-(dimethylamino)pyrimidin-5-yl]but-3-ynyl]carbamate |
| SMILES | CN(C)c1ncc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cn1 |
| InChI | InChI=1S/C25H24N4O2/c1-29(2)24-27-15-18(16-28-24)9-7-8-14-26-25(30)31-17-23-21-12-5-3-10-19(21)20-11-4-6-13-22(20)23/h3-6,10-13,15-16,23H,8,14,17H2,1-2H3,(H,26,30) |
| InChIKey | NTVJGMPDFPRUTR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|