C23H18ClN3O2 — CID 170460165
9H-fluoren-9-ylmethyl N-[4-(2-chloropyrimidin-5-yl)but-3-ynyl]carbamate (PubChem CID 170460165) has the molecular formula C23H18ClN3O2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-chloropyrimidin-5-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-chloropyrimidin-5-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460165 |
| Molecular Formula | C23H18ClN3O2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-chloropyrimidin-5-yl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cnc(Cl)nc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H18ClN3O2/c24-22-26-13-16(14-27-22)7-5-6-12-25-23(28)29-15-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-4,8-11,13-14,21H,6,12,15H2,(H,25,28) |
| InChIKey | COHRKHGSQNUYSO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|