C24H20ClN3O2 — CID 170461820
9H-fluoren-9-ylmethyl N-[4-(4-amino-2-chloro-3-pyridinyl)but-3-ynyl]carbamate (PubChem CID 170461820) has the molecular formula C24H20ClN3O2 and a molecular weight of 417.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(4-amino-2-chloro-3-pyridinyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(4-amino-2-chloro-3-pyridinyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461820 |
| Molecular Formula | C24H20ClN3O2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(4-amino-2-chloro-3-pyridinyl)but-3-ynyl]carbamate |
| SMILES | Nc1ccnc(Cl)c1C#CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H20ClN3O2/c25-23-20(22(26)12-14-27-23)11-5-6-13-28-24(29)30-15-21-18-9-3-1-7-16(18)17-8-2-4-10-19(17)21/h1-4,7-10,12,14,21H,6,13,15H2,(H2,26,27)(H,28,29) |
| InChIKey | HCPSFYCWLWUMGB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|