C26H23N3O2 — CID 170460882
9H-fluoren-9-ylmethyl N-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)but-3-ynyl]carbamate (PubChem CID 170460882) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460882 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1cnc2c(c1)CCN2)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H23N3O2/c30-26(28-13-6-5-7-18-15-19-12-14-27-25(19)29-16-18)31-17-24-22-10-3-1-8-20(22)21-9-2-4-11-23(21)24/h1-4,8-11,15-16,24H,6,12-14,17H2,(H,27,29)(H,28,30) |
| InChIKey | WDZIVWKINNVCIU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|