C28H23NO3 — CID 170460919
9H-fluoren-9-ylmethyl N-[4-(3-oxo-1,2-dihydroinden-5-yl)but-3-ynyl]carbamate (PubChem CID 170460919) has the molecular formula C28H23NO3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-oxo-1,2-dihydroinden-5-yl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-oxo-1,2-dihydroinden-5-yl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460919 |
| Molecular Formula | C28H23NO3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-oxo-1,2-dihydroinden-5-yl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc2c(c1)C(=O)CC2)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H23NO3/c30-27-15-14-20-13-12-19(17-25(20)27)7-5-6-16-29-28(31)32-18-26-23-10-3-1-8-21(23)22-9-2-4-11-24(22)26/h1-4,8-13,17,26H,6,14-16,18H2,(H,29,31) |
| InChIKey | VMYZABIRLHGPHS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|