C23H20N2O3S — CID 170460227
9H-fluoren-9-ylmethyl N-[4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-ynyl]carbamate (PubChem CID 170460227) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460227 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[4-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1nc(CO)cs1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C23H20N2O3S/c26-13-16-15-29-22(25-16)11-5-6-12-24-23(27)28-14-21-19-9-3-1-7-17(19)18-8-2-4-10-20(18)21/h1-4,7-10,15,21,26H,6,12-14H2,(H,24,27) |
| InChIKey | UUVDFFBTQKZVEM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|