C17H17NO3S — CID 170461952
benzyl N-[4-[5-(hydroxymethyl)thiophen-2-yl]but-3-ynyl]carbamate (PubChem CID 170461952) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is benzyl N-[4-[5-(hydroxymethyl)thiophen-2-yl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[5-(hydroxymethyl)thiophen-2-yl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461952 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | benzyl N-[4-[5-(hydroxymethyl)thiophen-2-yl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc(CO)s1)OCc1ccccc1 |
| InChI | InChI=1S/C17H17NO3S/c19-12-16-10-9-15(22-16)8-4-5-11-18-17(20)21-13-14-6-2-1-3-7-14/h1-3,6-7,9-10,19H,5,11-13H2,(H,18,20) |
| InChIKey | YJHVGCNLEJGDIS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|