C25H21NO4S — CID 170460582
methyl 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]thiophene-2-carboxylate (PubChem CID 170460582) has the molecular formula C25H21NO4S and a molecular weight of 431.51 g/mol. Its IUPAC name is methyl 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 170460582 |
| Molecular Formula | C25H21NO4S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | methyl 5-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)s1 |
| InChI | InChI=1S/C25H21NO4S/c1-29-24(27)23-14-13-17(31-23)8-6-7-15-26-25(28)30-16-22-20-11-4-2-9-18(20)19-10-3-5-12-21(19)22/h2-5,9-14,22H,7,15-16H2,1H3,(H,26,28) |
| InChIKey | MYVMBPRWQJGVRT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|