C26H19BrF3NO2 — CID 170461870
9H-fluoren-9-ylmethyl N-[4-[4-bromo-2-(trifluoromethyl)phenyl]but-3-ynyl]carbamate (PubChem CID 170461870) has the molecular formula C26H19BrF3NO2 and a molecular weight of 514.34 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[4-bromo-2-(trifluoromethyl)phenyl]but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[4-bromo-2-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170461870 |
| Molecular Formula | C26H19BrF3NO2 |
| Molecular Weight | 514.34 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[4-bromo-2-(trifluoromethyl)phenyl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc(Br)cc1C(F)(F)F)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H19BrF3NO2/c27-18-13-12-17(24(15-18)26(28,29)30)7-5-6-14-31-25(32)33-16-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-4,8-13,15,23H,6,14,16H2,(H,31,32) |
| InChIKey | PGVRLNZAIYQEHF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.34 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|