C18H16N4O2 — CID 170462694
benzyl N-(4-pyrazolo[1,5-a]pyrimidin-3-ylbut-3-ynyl)carbamate (PubChem CID 170462694) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is benzyl N-(4-pyrazolo[1,5-a]pyrimidin-3-ylbut-3-ynyl)carbamate.
| Compound Name | benzyl N-(4-pyrazolo[1,5-a]pyrimidin-3-ylbut-3-ynyl)carbamate |
|---|---|
| PubChem CID | 170462694 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | benzyl N-(4-pyrazolo[1,5-a]pyrimidin-3-ylbut-3-ynyl)carbamate |
| SMILES | O=C(NCCC#Cc1cnn2cccnc12)OCc1ccccc1 |
| InChI | InChI=1S/C18H16N4O2/c23-18(24-14-15-7-2-1-3-8-15)20-10-5-4-9-16-13-21-22-12-6-11-19-17(16)22/h1-3,6-8,11-13H,5,10,14H2,(H,20,23) |
| InChIKey | ZWZVLIIZAWWALY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|