C17H15N3O4 — CID 170462509
benzyl N-[4-(5-nitro-2-pyridinyl)but-3-ynyl]carbamate (PubChem CID 170462509) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is benzyl N-[4-(5-nitro-2-pyridinyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(5-nitro-2-pyridinyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462509 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | benzyl N-[4-(5-nitro-2-pyridinyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc([N+](=O)[O-])cn1)OCc1ccccc1 |
| InChI | InChI=1S/C17H15N3O4/c21-17(24-13-14-6-2-1-3-7-14)18-11-5-4-8-15-9-10-16(12-19-15)20(22)23/h1-3,6-7,9-10,12H,5,11,13H2,(H,18,21) |
| InChIKey | UDVJXVMXYRWPCN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|