C17H15N3O5 — CID 170462918
benzyl N-[4-(5-hydroxy-6-nitro-2-pyridinyl)but-3-ynyl]carbamate (PubChem CID 170462918) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is benzyl N-[4-(5-hydroxy-6-nitro-2-pyridinyl)but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-(5-hydroxy-6-nitro-2-pyridinyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170462918 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | benzyl N-[4-(5-hydroxy-6-nitro-2-pyridinyl)but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc(O)c([N+](=O)[O-])n1)OCc1ccccc1 |
| InChI | InChI=1S/C17H15N3O5/c21-15-10-9-14(19-16(15)20(23)24)8-4-5-11-18-17(22)25-12-13-6-2-1-3-7-13/h1-3,6-7,9-10,21H,5,11-12H2,(H,18,22) |
| InChIKey | AHSCSSZVGNZUGL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|