C17H19N3O7 — CID 171888825
benzyl N-[3,4-dihydroxy-4-(5-hydroxy-6-nitro-2-pyridinyl)butyl]carbamate (PubChem CID 171888825) has the molecular formula C17H19N3O7 and a molecular weight of 377.35 g/mol. Its IUPAC name is benzyl N-[3,4-dihydroxy-4-(5-hydroxy-6-nitro-2-pyridinyl)butyl]carbamate.
| Compound Name | benzyl N-[3,4-dihydroxy-4-(5-hydroxy-6-nitro-2-pyridinyl)butyl]carbamate |
|---|---|
| PubChem CID | 171888825 |
| Molecular Formula | C17H19N3O7 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | benzyl N-[3,4-dihydroxy-4-(5-hydroxy-6-nitro-2-pyridinyl)butyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1ccc(O)c([N+](=O)[O-])n1)OCc1ccccc1 |
| InChI | InChI=1S/C17H19N3O7/c21-13(15(23)12-6-7-14(22)16(19-12)20(25)26)8-9-18-17(24)27-10-11-4-2-1-3-5-11/h1-7,13,15,21-23H,8-10H2,(H,18,24) |
| InChIKey | TYULQUPHUSGSTK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 155.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|