C13H13NO6 — CID 170484510
4-(3-methoxycarbonyl-4-methyl-5-nitrophenyl)but-3-enoic acid (PubChem CID 170484510) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is 4-(3-methoxycarbonyl-4-methyl-5-nitrophenyl)but-3-enoic acid.
| Compound Name | 4-(3-methoxycarbonyl-4-methyl-5-nitrophenyl)but-3-enoic acid |
|---|---|
| PubChem CID | 170484510 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-(3-methoxycarbonyl-4-methyl-5-nitrophenyl)but-3-enoic acid |
| SMILES | COC(=O)c1cc(C=CCC(=O)O)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H13NO6/c1-8-10(13(17)20-2)6-9(4-3-5-12(15)16)7-11(8)14(18)19/h3-4,6-7H,5H2,1-2H3,(H,15,16) |
| InChIKey | DBTNVPSLGYKMKU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|