C13H13NO5S — CID 170481002
5-(4-acetylsulfanylbut-1-enyl)-2-nitrobenzoic acid (PubChem CID 170481002) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is 5-(4-acetylsulfanylbut-1-enyl)-2-nitrobenzoic acid.
| Compound Name | 5-(4-acetylsulfanylbut-1-enyl)-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 170481002 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 5-(4-acetylsulfanylbut-1-enyl)-2-nitrobenzoic acid |
| SMILES | CC(=O)SCCC=Cc1ccc([N+](=O)[O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C13H13NO5S/c1-9(15)20-7-3-2-4-10-5-6-12(14(18)19)11(8-10)13(16)17/h2,4-6,8H,3,7H2,1H3,(H,16,17) |
| InChIKey | MQJLXSPQYRLLLU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|