C12H11F2NO3S — CID 170480778
S-[4-(4,5-difluoro-2-nitrophenyl)but-3-enyl] ethanethioate (PubChem CID 170480778) has the molecular formula C12H11F2NO3S and a molecular weight of 287.29 g/mol. Its IUPAC name is S-[4-(4,5-difluoro-2-nitrophenyl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(4,5-difluoro-2-nitrophenyl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480778 |
| Molecular Formula | C12H11F2NO3S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | S-[4-(4,5-difluoro-2-nitrophenyl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11F2NO3S/c1-8(16)19-5-3-2-4-9-6-10(13)11(14)7-12(9)15(17)18/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | DMSRKCJXGQVZLF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|