C12H14FNO3S2 — CID 170480774
S-[4-(2-fluoro-4-sulfamoylphenyl)but-3-enyl] ethanethioate (PubChem CID 170480774) has the molecular formula C12H14FNO3S2 and a molecular weight of 303.38 g/mol. Its IUPAC name is S-[4-(2-fluoro-4-sulfamoylphenyl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(2-fluoro-4-sulfamoylphenyl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480774 |
| Molecular Formula | C12H14FNO3S2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | S-[4-(2-fluoro-4-sulfamoylphenyl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C12H14FNO3S2/c1-9(15)18-7-3-2-4-10-5-6-11(8-12(10)13)19(14,16)17/h2,4-6,8H,3,7H2,1H3,(H2,14,16,17) |
| InChIKey | AKSSSYJWXKGZML-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|