C13H12F2O3S — CID 170481239
5-(4-acetylsulfanylbut-1-enyl)-2,4-difluorobenzoic acid (PubChem CID 170481239) has the molecular formula C13H12F2O3S and a molecular weight of 286.30 g/mol. Its IUPAC name is 5-(4-acetylsulfanylbut-1-enyl)-2,4-difluorobenzoic acid.
| Compound Name | 5-(4-acetylsulfanylbut-1-enyl)-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 170481239 |
| Molecular Formula | C13H12F2O3S |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-(4-acetylsulfanylbut-1-enyl)-2,4-difluorobenzoic acid |
| SMILES | CC(=O)SCCC=Cc1cc(C(=O)O)c(F)cc1F |
| InChI | InChI=1S/C13H12F2O3S/c1-8(16)19-5-3-2-4-9-6-10(13(17)18)12(15)7-11(9)14/h2,4,6-7H,3,5H2,1H3,(H,17,18) |
| InChIKey | UJGMVEHFGOPNFJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|