C13H12F4O2S — CID 170480968
S-[4-[2-fluoro-5-(trifluoromethoxy)phenyl]but-3-enyl] ethanethioate (PubChem CID 170480968) has the molecular formula C13H12F4O2S and a molecular weight of 308.30 g/mol. Its IUPAC name is S-[4-[2-fluoro-5-(trifluoromethoxy)phenyl]but-3-enyl] ethanethioate.
| Compound Name | S-[4-[2-fluoro-5-(trifluoromethoxy)phenyl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480968 |
| Molecular Formula | C13H12F4O2S |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | S-[4-[2-fluoro-5-(trifluoromethoxy)phenyl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cc(OC(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H12F4O2S/c1-9(18)20-7-3-2-4-10-8-11(5-6-12(10)14)19-13(15,16)17/h2,4-6,8H,3,7H2,1H3 |
| InChIKey | ZQUHIIZNKDMCOC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|