C14H14F2O2S — CID 170480685
S-[4-(5-acetyl-2,4-difluorophenyl)but-3-enyl] ethanethioate (PubChem CID 170480685) has the molecular formula C14H14F2O2S and a molecular weight of 284.33 g/mol. Its IUPAC name is S-[4-(5-acetyl-2,4-difluorophenyl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(5-acetyl-2,4-difluorophenyl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480685 |
| Molecular Formula | C14H14F2O2S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | S-[4-(5-acetyl-2,4-difluorophenyl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cc(C(C)=O)c(F)cc1F |
| InChI | InChI=1S/C14H14F2O2S/c1-9(17)12-7-11(13(15)8-14(12)16)5-3-4-6-19-10(2)18/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | BLPAIOOGGGOUKM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|