C12H12F2OS — CID 170479664
S-[4-(2,3-difluorophenyl)but-3-enyl] ethanethioate (PubChem CID 170479664) has the molecular formula C12H12F2OS and a molecular weight of 242.29 g/mol. Its IUPAC name is S-[4-(2,3-difluorophenyl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(2,3-difluorophenyl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170479664 |
| Molecular Formula | C12H12F2OS |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | S-[4-(2,3-difluorophenyl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cccc(F)c1F |
| InChI | InChI=1S/C12H12F2OS/c1-9(15)16-8-3-2-5-10-6-4-7-11(13)12(10)14/h2,4-7H,3,8H2,1H3 |
| InChIKey | XOBPVLHKALAITD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|